C23H25NO4 — CID 14750948
7-[2-hydroxy-3-(1,2,3,4-tetrahydronaphthalen-2-ylamino)propoxy]-4-methylchromen-2-one (PubChem CID 14750948) has the molecular formula C23H25NO4 and a molecular weight of 379.46 g/mol. Its IUPAC name is 7-[2-hydroxy-3-(1,2,3,4-tetrahydronaphthalen-2-ylamino)propoxy]-4-methylchromen-2-one.
| Compound Name | 7-[2-hydroxy-3-(1,2,3,4-tetrahydronaphthalen-2-ylamino)propoxy]-4-methylchromen-2-one |
|---|---|
| PubChem CID | 14750948 |
| Molecular Formula | C23H25NO4 |
| Molecular Weight | 379.46 g/mol |
| Exact Mass | 379.18 |
| IUPAC Name | 7-[2-hydroxy-3-(1,2,3,4-tetrahydronaphthalen-2-ylamino)propoxy]-4-methylchromen-2-one |
| SMILES | Cc1cc(=O)oc2cc(OCC(O)CNC3CCc4ccccc4C3)ccc12 |
| InChI | InChI=1S/C23H25NO4/c1-15-10-23(26)28-22-12-20(8-9-21(15)22)27-14-19(25)13-24-18-7-6-16-4-2-3-5-17(16)11-18/h2-5,8-10,12,18-19,24-25H,6-7,11,13-14H2,1H3 |
| InChIKey | FBHUIKHFQQBYIN-UHFFFAOYSA-N |
| XLogP | 2.99 |
| TPSA | 71.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.46 |
| LogP ≤ 5 | 2.99 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|