C27H52N4O4 — CID 147513426
N-methyl-2-[5-[4-[2-[[2-[4-(4-methylpiperidin-1-yl)butoxy]acetyl]amino]ethyl]piperidin-1-yl]pentoxy]acetamide (PubChem CID 147513426) has the molecular formula C27H52N4O4 and a molecular weight of 496.74 g/mol. Its IUPAC name is N-methyl-2-[5-[4-[2-[[2-[4-(4-methylpiperidin-1-yl)butoxy]acetyl]amino]ethyl]piperidin-1-yl]pentoxy]acetamide.
| Compound Name | N-methyl-2-[5-[4-[2-[[2-[4-(4-methylpiperidin-1-yl)butoxy]acetyl]amino]ethyl]piperidin-1-yl]pentoxy]acetamide |
|---|---|
| PubChem CID | 147513426 |
| Molecular Formula | C27H52N4O4 |
| Molecular Weight | 496.74 g/mol |
| Exact Mass | 496.40 |
| IUPAC Name | N-methyl-2-[5-[4-[2-[[2-[4-(4-methylpiperidin-1-yl)butoxy]acetyl]amino]ethyl]piperidin-1-yl]pentoxy]acetamide |
| SMILES | CNC(=O)COCCCCCN1CCC(CCNC(=O)COCCCCN2CCC(C)CC2)CC1 |
| InChI | InChI=1S/C27H52N4O4/c1-24-9-16-30(17-10-24)15-5-7-21-35-23-27(33)29-13-8-25-11-18-31(19-12-25)14-4-3-6-20-34-22-26(32)28-2/h24-25H,3-23H2,1-2H3,(H,28,32)(H,29,33) |
| InChIKey | FJTAVBPXLIPYLX-UHFFFAOYSA-N |
| XLogP | 2.67 |
| TPSA | 83.14 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 496.74 |
| LogP ≤ 5 | 2.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|