C31H38N2O5S — CID 14751773
N-[2-(3,4-dimethoxyphenyl)ethyl]-3-[4-(3-methyl-2-propan-2-ylindolizin-1-yl)sulfonylphenoxy]propan-1-amine (PubChem CID 14751773) has the molecular formula C31H38N2O5S and a molecular weight of 550.72 g/mol. Its IUPAC name is N-[2-(3,4-dimethoxyphenyl)ethyl]-3-[4-(3-methyl-2-propan-2-ylindolizin-1-yl)sulfonylphenoxy]propan-1-amine.
| Compound Name | N-[2-(3,4-dimethoxyphenyl)ethyl]-3-[4-(3-methyl-2-propan-2-ylindolizin-1-yl)sulfonylphenoxy]propan-1-amine |
|---|---|
| PubChem CID | 14751773 |
| Molecular Formula | C31H38N2O5S |
| Molecular Weight | 550.72 g/mol |
| Exact Mass | 550.25 |
| IUPAC Name | N-[2-(3,4-dimethoxyphenyl)ethyl]-3-[4-(3-methyl-2-propan-2-ylindolizin-1-yl)sulfonylphenoxy]propan-1-amine |
| SMILES | COc1ccc(CCNCCCOc2ccc(S(=O)(=O)c3c(C(C)C)c(C)n4ccccc34)cc2)cc1OC |
| InChI | InChI=1S/C31H38N2O5S/c1-22(2)30-23(3)33-19-7-6-9-27(33)31(30)39(34,35)26-13-11-25(12-14-26)38-20-8-17-32-18-16-24-10-15-28(36-4)29(21-24)37-5/h6-7,9-15,19,21-22,32H,8,16-18,20H2,1-5H3 |
| InChIKey | DSEJGXNRPCEAIU-UHFFFAOYSA-N |
| XLogP | 5.82 |
| TPSA | 78.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 550.72 |
| LogP ≤ 5 | 5.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|