About 3-(4-chlorophenyl)-1,1-dioxo-1,3-thiazolidin-4-one
3-(4-chlorophenyl)-1,1-dioxo-1,3-thiazolidin-4-one (PubChem CID 1475315) has the molecular formula C9H8ClNO3S
and a molecular weight of 245.69 g/mol. Its IUPAC name is 3-(4-chlorophenyl)-1,1-dioxo-1,3-thiazolidin-4-one.
Molecular Properties
| Compound Name | 3-(4-chlorophenyl)-1,1-dioxo-1,3-thiazolidin-4-one |
| PubChem CID | 1475315 |
| Molecular Formula | C9H8ClNO3S |
| Molecular Weight | 245.69 g/mol |
| Exact Mass | 244.99 |
| IUPAC Name | 3-(4-chlorophenyl)-1,1-dioxo-1,3-thiazolidin-4-one |
| SMILES | O=C1CS(=O)(=O)CN1c1ccc(Cl)cc1 |
| InChI | InChI=1S/C9H8ClNO3S/c10-7-1-3-8(4-2-7)11-6-15(13,14)5-9(11)12/h1-4H,5-6H2 |
| InChIKey | NXWDYCLIBYGMQF-UHFFFAOYSA-N |
| XLogP | 1.06 |
| TPSA | 54.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 245.69 |
| LogP ≤ 5 | 1.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 3-(4-chlorophenyl)-1,1-dioxo-1,3-thiazolidin-4-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(4-chlorophenyl)-1,1-dioxo-1,3-thiazolidin-4-one?
The IUPAC name of 3-(4-chlorophenyl)-1,1-dioxo-1,3-thiazolidin-4-one (CID 1475315) is 3-(4-chlorophenyl)-1,1-dioxo-1,3-thiazolidin-4-one.
What is the SMILES notation for 3-(4-chlorophenyl)-1,1-dioxo-1,3-thiazolidin-4-one?
The canonical SMILES for 3-(4-chlorophenyl)-1,1-dioxo-1,3-thiazolidin-4-one is O=C1CS(=O)(=O)CN1c1ccc(Cl)cc1.
What is the InChIKey of 3-(4-chlorophenyl)-1,1-dioxo-1,3-thiazolidin-4-one?
The InChIKey is NXWDYCLIBYGMQF-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H8ClNO3S/c10-7-1-3-8(4-2-7)11-6-15(13,14)5-9(11)12/h1-4H,5-6H2.
What are the key properties of 3-(4-chlorophenyl)-1,1-dioxo-1,3-thiazolidin-4-one?
3-(4-chlorophenyl)-1,1-dioxo-1,3-thiazolidin-4-one has a molecular weight of 245.69 g/mol, XLogP of 1.06, 1 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(4-chlorophenyl)-1,1-dioxo-1,3-thiazolidin-4-one is sourced from PubChem (CID 1475315), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).