C9H8ClNO3S — CID 1475315
3-(4-chlorophenyl)-1,1-dioxo-1,3-thiazolidin-4-one (PubChem CID 1475315) has the molecular formula C9H8ClNO3S and a molecular weight of 245.69 g/mol. Its IUPAC name is 3-(4-chlorophenyl)-1,1-dioxo-1,3-thiazolidin-4-one.
| Compound Name | 3-(4-chlorophenyl)-1,1-dioxo-1,3-thiazolidin-4-one |
|---|---|
| PubChem CID | 1475315 |
| Molecular Formula | C9H8ClNO3S |
| Molecular Weight | 245.69 g/mol |
| Exact Mass | 244.99 |
| IUPAC Name | 3-(4-chlorophenyl)-1,1-dioxo-1,3-thiazolidin-4-one |
| SMILES | O=C1CS(=O)(=O)CN1c1ccc(Cl)cc1 |
| InChI | InChI=1S/C9H8ClNO3S/c10-7-1-3-8(4-2-7)11-6-15(13,14)5-9(11)12/h1-4H,5-6H2 |
| InChIKey | NXWDYCLIBYGMQF-UHFFFAOYSA-N |
| XLogP | 1.06 |
| TPSA | 54.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 245.69 |
| LogP ≤ 5 | 1.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |