C13H15FN4O3 — CID 147539086
(1R,3S,4S,5R)-3-(4-aminopyrrolo[2,1-f][1,2,4]triazin-7-yl)-1-ethyl-4-fluoro-2-oxabicyclo[3.1.0]hexane-5,6-diol (PubChem CID 147539086) has the molecular formula C13H15FN4O3 and a molecular weight of 294.29 g/mol. Its IUPAC name is (1R,3S,4S,5R)-3-(4-aminopyrrolo[2,1-f][1,2,4]triazin-7-yl)-1-ethyl-4-fluoro-2-oxabicyclo[3.1.0]hexane-5,6-diol.
| Compound Name | (1R,3S,4S,5R)-3-(4-aminopyrrolo[2,1-f][1,2,4]triazin-7-yl)-1-ethyl-4-fluoro-2-oxabicyclo[3.1.0]hexane-5,6-diol |
|---|---|
| PubChem CID | 147539086 |
| Molecular Formula | C13H15FN4O3 |
| Molecular Weight | 294.29 g/mol |
| Exact Mass | 294.11 |
| IUPAC Name | (1R,3S,4S,5R)-3-(4-aminopyrrolo[2,1-f][1,2,4]triazin-7-yl)-1-ethyl-4-fluoro-2-oxabicyclo[3.1.0]hexane-5,6-diol |
| SMILES | CC[C@]12O[C@@H](c3ccc4c(N)ncnn34)[C@H](F)[C@@]1(O)C2O |
| InChI | InChI=1S/C13H15FN4O3/c1-2-12-11(19)13(12,20)9(14)8(21-12)6-3-4-7-10(15)16-5-17-18(6)7/h3-5,8-9,11,19-20H,2H2,1H3,(H2,15,16,17)/t8-,9-,11?,12+,13+/m0/s1 |
| InChIKey | FONQSLJUOOQVLU-RBDMLBJQSA-N |
| XLogP | -0.02 |
| TPSA | 105.90 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.29 |
| LogP ≤ 5 | -0.02 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |