C33H44N2O7 — CID 147543941
methyl (1R,18R,22R,26S,29S)-26-tert-butyl-11,24,27-trioxo-2,23-dioxa-4,28-diazapentacyclo[26.2.1.03,12.05,10.018,22]hentriaconta-3(12),5,7,9-tetraene-29-carboxylate (PubChem CID 147543941) has the molecular formula C33H44N2O7 and a molecular weight of 580.72 g/mol. Its IUPAC name is methyl (1R,18R,22R,26S,29S)-26-tert-butyl-11,24,27-trioxo-2,23-dioxa-4,28-diazapentacyclo[26.2.1.03,12.05,10.018,22]hentriaconta-3(12),5,7,9-tetraene-29-carboxylate.
| Compound Name | methyl (1R,18R,22R,26S,29S)-26-tert-butyl-11,24,27-trioxo-2,23-dioxa-4,28-diazapentacyclo[26.2.1.03,12.05,10.018,22]hentriaconta-3(12),5,7,9-tetraene-29-carboxylate |
|---|---|
| PubChem CID | 147543941 |
| Molecular Formula | C33H44N2O7 |
| Molecular Weight | 580.72 g/mol |
| Exact Mass | 580.31 |
| IUPAC Name | methyl (1R,18R,22R,26S,29S)-26-tert-butyl-11,24,27-trioxo-2,23-dioxa-4,28-diazapentacyclo[26.2.1.03,12.05,10.018,22]hentriaconta-3(12),5,7,9-tetraene-29-carboxylate |
| SMILES | COC(=O)[C@@H]1C[C@@H]2CN1C(=O)[C@H](C(C)(C)C)CC(=O)O[C@@H]1CCC[C@H]1CCCCCc1c([nH]c3ccccc3c1=O)O2 |
| InChI | InChI=1S/C33H44N2O7/c1-33(2,3)24-18-28(36)42-27-16-10-12-20(27)11-6-5-7-14-23-29(37)22-13-8-9-15-25(22)34-30(23)41-21-17-26(32(39)40-4)35(19-21)31(24)38/h8-9,13,15,20-21,24,26-27H,5-7,10-12,14,16-19H2,1-4H3,(H,34,37)/t20-,21-,24-,26+,27-/m1/s1 |
| InChIKey | FPLLXCJMLPNFFN-GULVOLPFSA-N |
| XLogP | 4.93 |
| TPSA | 115.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 42 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 580.72 |
| LogP ≤ 5 | 4.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |