C31H41N3O7 — CID 121297611
(1R,18R,22R,26S,29S)-26-tert-butyl-11,24,27-trioxo-2,23-dioxa-4,25,28-triazapentacyclo[26.2.1.03,12.05,10.018,22]hentriaconta-3(12),5,7,9-tetraene-29-carboxylic acid (PubChem CID 121297611) has the molecular formula C31H41N3O7 and a molecular weight of 567.68 g/mol. Its IUPAC name is (1R,18R,22R,26S,29S)-26-tert-butyl-11,24,27-trioxo-2,23-dioxa-4,25,28-triazapentacyclo[26.2.1.03,12.05,10.018,22]hentriaconta-3(12),5,7,9-tetraene-29-carboxylic acid.
| Compound Name | (1R,18R,22R,26S,29S)-26-tert-butyl-11,24,27-trioxo-2,23-dioxa-4,25,28-triazapentacyclo[26.2.1.03,12.05,10.018,22]hentriaconta-3(12),5,7,9-tetraene-29-carboxylic acid |
|---|---|
| PubChem CID | 121297611 |
| Molecular Formula | C31H41N3O7 |
| Molecular Weight | 567.68 g/mol |
| Exact Mass | 567.29 |
| IUPAC Name | (1R,18R,22R,26S,29S)-26-tert-butyl-11,24,27-trioxo-2,23-dioxa-4,25,28-triazapentacyclo[26.2.1.03,12.05,10.018,22]hentriaconta-3(12),5,7,9-tetraene-29-carboxylic acid |
| SMILES | CC(C)(C)[C@@H]1NC(=O)O[C@@H]2CCC[C@H]2CCCCCc2c([nH]c3ccccc3c2=O)O[C@@H]2C[C@@H](C(=O)O)N(C2)C1=O |
| InChI | InChI=1S/C31H41N3O7/c1-31(2,3)26-28(36)34-17-19(16-23(34)29(37)38)40-27-21(25(35)20-12-7-8-14-22(20)32-27)13-6-4-5-10-18-11-9-15-24(18)41-30(39)33-26/h7-8,12,14,18-19,23-24,26H,4-6,9-11,13,15-17H2,1-3H3,(H,32,35)(H,33,39)(H,37,38)/t18-,19-,23+,24-,26-/m1/s1 |
| InChIKey | VHLSNHLABJBVTE-XMWCPUMHSA-N |
| XLogP | 4.39 |
| TPSA | 138.03 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 567.68 |
| LogP ≤ 5 | 4.39 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |