C23H28N4O6S — CID 147560284
tert-butyl 4-[[(4,10,10-trioxo-5H-pyrrolo[1,2-b][1,2,5]benzothiadiazepine-7-carbonyl)amino]methyl]piperidine-1-carboxylate (PubChem CID 147560284) has the molecular formula C23H28N4O6S and a molecular weight of 488.57 g/mol. Its IUPAC name is tert-butyl 4-[[(4,10,10-trioxo-5H-pyrrolo[1,2-b][1,2,5]benzothiadiazepine-7-carbonyl)amino]methyl]piperidine-1-carboxylate.
| Compound Name | tert-butyl 4-[[(4,10,10-trioxo-5H-pyrrolo[1,2-b][1,2,5]benzothiadiazepine-7-carbonyl)amino]methyl]piperidine-1-carboxylate |
|---|---|
| PubChem CID | 147560284 |
| Molecular Formula | C23H28N4O6S |
| Molecular Weight | 488.57 g/mol |
| Exact Mass | 488.17 |
| IUPAC Name | tert-butyl 4-[[(4,10,10-trioxo-5H-pyrrolo[1,2-b][1,2,5]benzothiadiazepine-7-carbonyl)amino]methyl]piperidine-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CCC(CNC(=O)c2ccc3c(c2)NC(=O)c2cccn2S3(=O)=O)CC1 |
| InChI | InChI=1S/C23H28N4O6S/c1-23(2,3)33-22(30)26-11-8-15(9-12-26)14-24-20(28)16-6-7-19-17(13-16)25-21(29)18-5-4-10-27(18)34(19,31)32/h4-7,10,13,15H,8-9,11-12,14H2,1-3H3,(H,24,28)(H,25,29) |
| InChIKey | FSMMTSXCEDMQSQ-UHFFFAOYSA-N |
| XLogP | 2.67 |
| TPSA | 126.81 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 488.57 |
| LogP ≤ 5 | 2.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |