C21H27N3O5S — CID 147561444
4-[(2,3-dimethoxyphenyl)methyl]-2-methyl-1-[4-(sulfinoamino)benzoyl]piperazine (PubChem CID 147561444) has the molecular formula C21H27N3O5S and a molecular weight of 433.53 g/mol. Its IUPAC name is 4-[(2,3-dimethoxyphenyl)methyl]-2-methyl-1-[4-(sulfinoamino)benzoyl]piperazine.
| Compound Name | 4-[(2,3-dimethoxyphenyl)methyl]-2-methyl-1-[4-(sulfinoamino)benzoyl]piperazine |
|---|---|
| PubChem CID | 147561444 |
| Molecular Formula | C21H27N3O5S |
| Molecular Weight | 433.53 g/mol |
| Exact Mass | 433.17 |
| IUPAC Name | 4-[(2,3-dimethoxyphenyl)methyl]-2-methyl-1-[4-(sulfinoamino)benzoyl]piperazine |
| SMILES | COc1cccc(CN2CCN(C(=O)c3ccc(NS(=O)O)cc3)C(C)C2)c1OC |
| InChI | InChI=1S/C21H27N3O5S/c1-15-13-23(14-17-5-4-6-19(28-2)20(17)29-3)11-12-24(15)21(25)16-7-9-18(10-8-16)22-30(26)27/h4-10,15,22H,11-14H2,1-3H3,(H,26,27) |
| InChIKey | IZCFOOCIUPSJGR-UHFFFAOYSA-N |
| XLogP | 2.60 |
| TPSA | 91.34 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.53 |
| LogP ≤ 5 | 2.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'sulfinic_acid', 'substructure': 'N/A'} |
|---|