C9H17N3 — CID 147561473
4-methylimino-3-pyrrolidin-2-ylbut-2-en-2-amine (PubChem CID 147561473) has the molecular formula C9H17N3 and a molecular weight of 167.26 g/mol. Its IUPAC name is 4-methylimino-3-pyrrolidin-2-ylbut-2-en-2-amine.
| Compound Name | 4-methylimino-3-pyrrolidin-2-ylbut-2-en-2-amine |
|---|---|
| PubChem CID | 147561473 |
| Molecular Formula | C9H17N3 |
| Molecular Weight | 167.26 g/mol |
| Exact Mass | 167.14 |
| IUPAC Name | 4-methylimino-3-pyrrolidin-2-ylbut-2-en-2-amine |
| SMILES | C/N=C/C(=C(C)N)C1CCCN1 |
| InChI | InChI=1S/C9H17N3/c1-7(10)8(6-11-2)9-4-3-5-12-9/h6,9,12H,3-5,10H2,1-2H3/b8-7?,11-6+ |
| InChIKey | GIWCVLGZJOWTKV-RRSLYZDTSA-N |
| XLogP | 0.67 |
| TPSA | 50.41 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 167.26 |
| LogP ≤ 5 | 0.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|