C23H26N4O2S — CID 147565092
[5-[(E)-1-(aziridin-2-ylimino)but-2-en-2-yl]thiophen-3-yl]-(3-hydroxy-3-pyridin-2-yl-8-azabicyclo[3.2.1]octan-8-yl)methanone (PubChem CID 147565092) has the molecular formula C23H26N4O2S and a molecular weight of 422.55 g/mol. Its IUPAC name is [5-[(E)-1-(aziridin-2-ylimino)but-2-en-2-yl]thiophen-3-yl]-(3-hydroxy-3-pyridin-2-yl-8-azabicyclo[3.2.1]octan-8-yl)methanone.
| Compound Name | [5-[(E)-1-(aziridin-2-ylimino)but-2-en-2-yl]thiophen-3-yl]-(3-hydroxy-3-pyridin-2-yl-8-azabicyclo[3.2.1]octan-8-yl)methanone |
|---|---|
| PubChem CID | 147565092 |
| Molecular Formula | C23H26N4O2S |
| Molecular Weight | 422.55 g/mol |
| Exact Mass | 422.18 |
| IUPAC Name | [5-[(E)-1-(aziridin-2-ylimino)but-2-en-2-yl]thiophen-3-yl]-(3-hydroxy-3-pyridin-2-yl-8-azabicyclo[3.2.1]octan-8-yl)methanone |
| SMILES | C/C=C(\C=NC1CN1)c1cc(C(=O)N2C3CCC2CC(O)(c2ccccn2)C3)cs1 |
| InChI | InChI=1S/C23H26N4O2S/c1-2-15(12-25-21-13-26-21)19-9-16(14-30-19)22(28)27-17-6-7-18(27)11-23(29,10-17)20-5-3-4-8-24-20/h2-5,8-9,12,14,17-18,21,26,29H,6-7,10-11,13H2,1H3/b15-2+,25-12? |
| InChIKey | FTKFGFWCXWHJMT-OLHHKGKWSA-N |
| XLogP | 3.20 |
| TPSA | 87.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.55 |
| LogP ≤ 5 | 3.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|