C20H21FN2O3 — CID 95799342
[(1R,5S)-3-(2-fluoro-3-pyridinyl)-3-hydroxy-8-azabicyclo[3.2.1]octan-8-yl]-(3-methoxyphenyl)methanone (PubChem CID 95799342) has the molecular formula C20H21FN2O3 and a molecular weight of 356.40 g/mol. Its IUPAC name is [(1R,5S)-3-(2-fluoro-3-pyridinyl)-3-hydroxy-8-azabicyclo[3.2.1]octan-8-yl]-(3-methoxyphenyl)methanone.
| Compound Name | [(1R,5S)-3-(2-fluoro-3-pyridinyl)-3-hydroxy-8-azabicyclo[3.2.1]octan-8-yl]-(3-methoxyphenyl)methanone |
|---|---|
| PubChem CID | 95799342 |
| Molecular Formula | C20H21FN2O3 |
| Molecular Weight | 356.40 g/mol |
| Exact Mass | 356.15 |
| IUPAC Name | [(1R,5S)-3-(2-fluoro-3-pyridinyl)-3-hydroxy-8-azabicyclo[3.2.1]octan-8-yl]-(3-methoxyphenyl)methanone |
| SMILES | COc1cccc(C(=O)N2[C@@H]3CC[C@H]2CC(O)(c2cccnc2F)C3)c1 |
| InChI | InChI=1S/C20H21FN2O3/c1-26-16-5-2-4-13(10-16)19(24)23-14-7-8-15(23)12-20(25,11-14)17-6-3-9-22-18(17)21/h2-6,9-10,14-15,25H,7-8,11-12H2,1H3/t14-,15+,20? |
| InChIKey | PAKHSPBYWQAXLT-DBIVSCPCSA-N |
| XLogP | 2.88 |
| TPSA | 62.66 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.40 |
| LogP ≤ 5 | 2.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|