C27H38N2O6 — CID 147588110
benzyl 4-[(3aS,5S,6aR)-5-[[(3S,4S)-3-methoxyoxan-4-yl]methyl]-2,3,4,5,6,6a-hexahydrocyclopenta[b]furan-3a-carbonyl]piperazine-1-carboxylate (PubChem CID 147588110) has the molecular formula C27H38N2O6 and a molecular weight of 486.61 g/mol. Its IUPAC name is benzyl 4-[(3aS,5S,6aR)-5-[[(3S,4S)-3-methoxyoxan-4-yl]methyl]-2,3,4,5,6,6a-hexahydrocyclopenta[b]furan-3a-carbonyl]piperazine-1-carboxylate.
| Compound Name | benzyl 4-[(3aS,5S,6aR)-5-[[(3S,4S)-3-methoxyoxan-4-yl]methyl]-2,3,4,5,6,6a-hexahydrocyclopenta[b]furan-3a-carbonyl]piperazine-1-carboxylate |
|---|---|
| PubChem CID | 147588110 |
| Molecular Formula | C27H38N2O6 |
| Molecular Weight | 486.61 g/mol |
| Exact Mass | 486.27 |
| IUPAC Name | benzyl 4-[(3aS,5S,6aR)-5-[[(3S,4S)-3-methoxyoxan-4-yl]methyl]-2,3,4,5,6,6a-hexahydrocyclopenta[b]furan-3a-carbonyl]piperazine-1-carboxylate |
| SMILES | CO[C@@H]1COCC[C@@H]1C[C@@H]1C[C@H]2OCC[C@@]2(C(=O)N2CCN(C(=O)OCc3ccccc3)CC2)C1 |
| InChI | InChI=1S/C27H38N2O6/c1-32-23-19-33-13-7-22(23)15-21-16-24-27(17-21,8-14-34-24)25(30)28-9-11-29(12-10-28)26(31)35-18-20-5-3-2-4-6-20/h2-6,21-24H,7-19H2,1H3/t21-,22-,23-,24-,27-/m1/s1 |
| InChIKey | FXTCONNEHOIGPY-XMPCBSOPSA-N |
| XLogP | 3.09 |
| TPSA | 77.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 486.61 |
| LogP ≤ 5 | 3.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |