C21H22N5O2+ — CID 147594852
[[3-methyl-2-[(6-methyl-5-phenyl-2-pyridinyl)oxymethyl]phenyl]carbamoylhydrazinylidene]azanium (PubChem CID 147594852) has the molecular formula C21H22N5O2+ and a molecular weight of 376.44 g/mol. Its IUPAC name is [[3-methyl-2-[(6-methyl-5-phenyl-2-pyridinyl)oxymethyl]phenyl]carbamoylhydrazinylidene]azanium.
| Compound Name | [[3-methyl-2-[(6-methyl-5-phenyl-2-pyridinyl)oxymethyl]phenyl]carbamoylhydrazinylidene]azanium |
|---|---|
| PubChem CID | 147594852 |
| Molecular Formula | C21H22N5O2+ |
| Molecular Weight | 376.44 g/mol |
| Exact Mass | 376.18 |
| IUPAC Name | [[3-methyl-2-[(6-methyl-5-phenyl-2-pyridinyl)oxymethyl]phenyl]carbamoylhydrazinylidene]azanium |
| SMILES | Cc1cccc(NC(=O)NN=[NH2+])c1COc1ccc(-c2ccccc2)c(C)n1 |
| InChI | InChI=1S/C21H21N5O2/c1-14-7-6-10-19(24-21(27)25-26-22)18(14)13-28-20-12-11-17(15(2)23-20)16-8-4-3-5-9-16/h3-12H,13H2,1-2H3,(H3,22,24,25,27)/p+1 |
| InChIKey | FYZGUBZKWSLWGW-UHFFFAOYSA-O |
| XLogP | 3.19 |
| TPSA | 101.20 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.44 |
| LogP ≤ 5 | 3.19 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|