C20H19F3O7S — CID 14759557
[(3R,4R,5S)-2-oxo-4-phenylmethoxy-5-(phenylmethoxymethyl)oxolan-3-yl] trifluoromethanesulfonate (PubChem CID 14759557) has the molecular formula C20H19F3O7S and a molecular weight of 460.43 g/mol. Its IUPAC name is [(3R,4R,5S)-2-oxo-4-phenylmethoxy-5-(phenylmethoxymethyl)oxolan-3-yl] trifluoromethanesulfonate.
| Compound Name | [(3R,4R,5S)-2-oxo-4-phenylmethoxy-5-(phenylmethoxymethyl)oxolan-3-yl] trifluoromethanesulfonate |
|---|---|
| PubChem CID | 14759557 |
| Molecular Formula | C20H19F3O7S |
| Molecular Weight | 460.43 g/mol |
| Exact Mass | 460.08 |
| IUPAC Name | [(3R,4R,5S)-2-oxo-4-phenylmethoxy-5-(phenylmethoxymethyl)oxolan-3-yl] trifluoromethanesulfonate |
| SMILES | O=C1O[C@@H](COCc2ccccc2)[C@@H](OCc2ccccc2)[C@H]1OS(=O)(=O)C(F)(F)F |
| InChI | InChI=1S/C20H19F3O7S/c21-20(22,23)31(25,26)30-18-17(28-12-15-9-5-2-6-10-15)16(29-19(18)24)13-27-11-14-7-3-1-4-8-14/h1-10,16-18H,11-13H2/t16-,17+,18+/m0/s1 |
| InChIKey | LQZZXZZTIQTCEK-RCCFBDPRSA-N |
| XLogP | 2.95 |
| TPSA | 88.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 460.43 |
| LogP ≤ 5 | 2.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'}, {'alert_name': 'triflate', 'substructure': 'N/A'} |
|---|