C13H11F3O7S — CID 11474107
[(2R,3aR,7R,7aR)-6-oxo-2-phenyl-3a,4,7,7a-tetrahydro-[1,3]dioxolo[4,5-c]pyran-7-yl] trifluoromethanesulfonate (PubChem CID 11474107) has the molecular formula C13H11F3O7S and a molecular weight of 368.29 g/mol. Its IUPAC name is [(2R,3aR,7R,7aR)-6-oxo-2-phenyl-3a,4,7,7a-tetrahydro-[1,3]dioxolo[4,5-c]pyran-7-yl] trifluoromethanesulfonate.
| Compound Name | [(2R,3aR,7R,7aR)-6-oxo-2-phenyl-3a,4,7,7a-tetrahydro-[1,3]dioxolo[4,5-c]pyran-7-yl] trifluoromethanesulfonate |
|---|---|
| PubChem CID | 11474107 |
| Molecular Formula | C13H11F3O7S |
| Molecular Weight | 368.29 g/mol |
| Exact Mass | 368.02 |
| IUPAC Name | [(2R,3aR,7R,7aR)-6-oxo-2-phenyl-3a,4,7,7a-tetrahydro-[1,3]dioxolo[4,5-c]pyran-7-yl] trifluoromethanesulfonate |
| SMILES | O=C1OC[C@H]2O[C@@H](c3ccccc3)O[C@H]2[C@H]1OS(=O)(=O)C(F)(F)F |
| InChI | InChI=1S/C13H11F3O7S/c14-13(15,16)24(18,19)23-10-9-8(6-20-11(10)17)21-12(22-9)7-4-2-1-3-5-7/h1-5,8-10,12H,6H2/t8-,9-,10-,12-/m1/s1 |
| InChIKey | CQTSKCCAINXKOS-DNRKLUKYSA-N |
| XLogP | 1.26 |
| TPSA | 88.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.29 |
| LogP ≤ 5 | 1.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'}, {'alert_name': 'triflate', 'substructure': 'N/A'} |
|---|