C26H31N3O2 — CID 147606596
(5aR,6R,9aS)-3-(2-methoxyethyl)-6,9a-dimethyl-7-oxo-2-(4-propan-2-ylphenyl)-4,5,5a,6-tetrahydrobenzo[e]benzimidazole-8-carbonitrile (PubChem CID 147606596) has the molecular formula C26H31N3O2 and a molecular weight of 417.55 g/mol. Its IUPAC name is (5aR,6R,9aS)-3-(2-methoxyethyl)-6,9a-dimethyl-7-oxo-2-(4-propan-2-ylphenyl)-4,5,5a,6-tetrahydrobenzo[e]benzimidazole-8-carbonitrile.
| Compound Name | (5aR,6R,9aS)-3-(2-methoxyethyl)-6,9a-dimethyl-7-oxo-2-(4-propan-2-ylphenyl)-4,5,5a,6-tetrahydrobenzo[e]benzimidazole-8-carbonitrile |
|---|---|
| PubChem CID | 147606596 |
| Molecular Formula | C26H31N3O2 |
| Molecular Weight | 417.55 g/mol |
| Exact Mass | 417.24 |
| IUPAC Name | (5aR,6R,9aS)-3-(2-methoxyethyl)-6,9a-dimethyl-7-oxo-2-(4-propan-2-ylphenyl)-4,5,5a,6-tetrahydrobenzo[e]benzimidazole-8-carbonitrile |
| SMILES | COCCn1c(-c2ccc(C(C)C)cc2)nc2c1CC[C@@H]1[C@@H](C)C(=O)C(C#N)=C[C@@]21C |
| InChI | InChI=1S/C26H31N3O2/c1-16(2)18-6-8-19(9-7-18)25-28-24-22(29(25)12-13-31-5)11-10-21-17(3)23(30)20(15-27)14-26(21,24)4/h6-9,14,16-17,21H,10-13H2,1-5H3/t17-,21-,26-/m1/s1 |
| InChIKey | GBELTDLEKCULAO-HIIGZGGBSA-N |
| XLogP | 4.81 |
| TPSA | 67.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.55 |
| LogP ≤ 5 | 4.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |