C25H23NO2S — CID 147613682
N-(3-benzyl-6-methylnaphthalen-2-yl)-4-methylbenzenesulfonamide (PubChem CID 147613682) has the molecular formula C25H23NO2S and a molecular weight of 401.53 g/mol. Its IUPAC name is N-(3-benzyl-6-methylnaphthalen-2-yl)-4-methylbenzenesulfonamide.
| Compound Name | N-(3-benzyl-6-methylnaphthalen-2-yl)-4-methylbenzenesulfonamide |
|---|---|
| PubChem CID | 147613682 |
| Molecular Formula | C25H23NO2S |
| Molecular Weight | 401.53 g/mol |
| Exact Mass | 401.14 |
| IUPAC Name | N-(3-benzyl-6-methylnaphthalen-2-yl)-4-methylbenzenesulfonamide |
| SMILES | Cc1ccc(S(=O)(=O)Nc2cc3ccc(C)cc3cc2Cc2ccccc2)cc1 |
| InChI | InChI=1S/C25H23NO2S/c1-18-9-12-24(13-10-18)29(27,28)26-25-17-21-11-8-19(2)14-22(21)16-23(25)15-20-6-4-3-5-7-20/h3-14,16-17,26H,15H2,1-2H3 |
| InChIKey | GCMLVIDDVYMTCR-UHFFFAOYSA-N |
| XLogP | 5.85 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.53 |
| LogP ≤ 5 | 5.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |