C9H12N2O4S — CID 1476335
methyl 2-(4,5-dimethoxypyrimidin-2-yl)sulfanylacetate (PubChem CID 1476335) has the molecular formula C9H12N2O4S and a molecular weight of 244.27 g/mol. Its IUPAC name is methyl 2-(4,5-dimethoxypyrimidin-2-yl)sulfanylacetate.
| Compound Name | methyl 2-(4,5-dimethoxypyrimidin-2-yl)sulfanylacetate |
|---|---|
| PubChem CID | 1476335 |
| Molecular Formula | C9H12N2O4S |
| Molecular Weight | 244.27 g/mol |
| Exact Mass | 244.05 |
| IUPAC Name | methyl 2-(4,5-dimethoxypyrimidin-2-yl)sulfanylacetate |
| SMILES | COC(=O)CSc1ncc(OC)c(OC)n1 |
| InChI | InChI=1S/C9H12N2O4S/c1-13-6-4-10-9(11-8(6)15-3)16-5-7(12)14-2/h4H,5H2,1-3H3 |
| InChIKey | KQRWDSKTXOHLRF-UHFFFAOYSA-N |
| XLogP | 0.76 |
| TPSA | 70.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 244.27 |
| LogP ≤ 5 | 0.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |