C8H10NY- — CID 147635783
1,3-dimethyl-6-methylidene-2H-pyridin-2-ide;yttrium (PubChem CID 147635783) has the molecular formula C8H10NY- and a molecular weight of 209.08 g/mol. Its IUPAC name is 1,3-dimethyl-6-methylidene-2H-pyridin-2-ide;yttrium.
| Compound Name | 1,3-dimethyl-6-methylidene-2H-pyridin-2-ide;yttrium |
|---|---|
| PubChem CID | 147635783 |
| Molecular Formula | C8H10NY- |
| Molecular Weight | 209.08 g/mol |
| Exact Mass | 208.99 |
| IUPAC Name | 1,3-dimethyl-6-methylidene-2H-pyridin-2-ide;yttrium |
| SMILES | C=C1C=CC(C)=[C-]N1C.[Y] |
| InChI | InChI=1S/C8H10N.Y/c1-7-4-5-8(2)9(3)6-7;/h4-5H,2H2,1,3H3;/q-1; |
| InChIKey | XMGVRJHGGOIETJ-UHFFFAOYSA-N |
| XLogP | 1.71 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 209.08 |
| LogP ≤ 5 | 1.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|