C18H23N5O2 — CID 147658932
2-[2-(4-aminopiperidin-1-yl)-5-methoxyphenyl]-1-(3-aminopyrazin-2-yl)ethanone (PubChem CID 147658932) has the molecular formula C18H23N5O2 and a molecular weight of 341.42 g/mol. Its IUPAC name is 2-[2-(4-aminopiperidin-1-yl)-5-methoxyphenyl]-1-(3-aminopyrazin-2-yl)ethanone.
| Compound Name | 2-[2-(4-aminopiperidin-1-yl)-5-methoxyphenyl]-1-(3-aminopyrazin-2-yl)ethanone |
|---|---|
| PubChem CID | 147658932 |
| Molecular Formula | C18H23N5O2 |
| Molecular Weight | 341.42 g/mol |
| Exact Mass | 341.19 |
| IUPAC Name | 2-[2-(4-aminopiperidin-1-yl)-5-methoxyphenyl]-1-(3-aminopyrazin-2-yl)ethanone |
| SMILES | COc1ccc(N2CCC(N)CC2)c(CC(=O)c2nccnc2N)c1 |
| InChI | InChI=1S/C18H23N5O2/c1-25-14-2-3-15(23-8-4-13(19)5-9-23)12(10-14)11-16(24)17-18(20)22-7-6-21-17/h2-3,6-7,10,13H,4-5,8-9,11,19H2,1H3,(H2,20,22) |
| InChIKey | GKYQXSQLRIQWGP-UHFFFAOYSA-N |
| XLogP | 1.42 |
| TPSA | 107.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.42 |
| LogP ≤ 5 | 1.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|