C20H23N7O — CID 147815467
2-[2-(4-aminopiperidin-1-yl)-5-(1H-pyrazol-5-yl)phenyl]-1-(3-aminopyrazin-2-yl)ethanone (PubChem CID 147815467) has the molecular formula C20H23N7O and a molecular weight of 377.45 g/mol. Its IUPAC name is 2-[2-(4-aminopiperidin-1-yl)-5-(1H-pyrazol-5-yl)phenyl]-1-(3-aminopyrazin-2-yl)ethanone.
| Compound Name | 2-[2-(4-aminopiperidin-1-yl)-5-(1H-pyrazol-5-yl)phenyl]-1-(3-aminopyrazin-2-yl)ethanone |
|---|---|
| PubChem CID | 147815467 |
| Molecular Formula | C20H23N7O |
| Molecular Weight | 377.45 g/mol |
| Exact Mass | 377.20 |
| IUPAC Name | 2-[2-(4-aminopiperidin-1-yl)-5-(1H-pyrazol-5-yl)phenyl]-1-(3-aminopyrazin-2-yl)ethanone |
| SMILES | Nc1nccnc1C(=O)Cc1cc(-c2ccn[nH]2)ccc1N1CCC(N)CC1 |
| InChI | InChI=1S/C20H23N7O/c21-15-4-9-27(10-5-15)17-2-1-13(16-3-6-25-26-16)11-14(17)12-18(28)19-20(22)24-8-7-23-19/h1-3,6-8,11,15H,4-5,9-10,12,21H2,(H2,22,24)(H,25,26) |
| InChIKey | HOFFDQOHRPUKGG-UHFFFAOYSA-N |
| XLogP | 1.80 |
| TPSA | 126.81 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.45 |
| LogP ≤ 5 | 1.80 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |