C30H24F9N3O3 — CID 147664571
5-[3-[4-fluoro-3,3-bis(fluoromethyl)butanoyl]phenyl]-2-(4-fluorophenyl)-N-methyl-6-(2,2,3,3,3-pentafluoropropylamino)furo[2,3-b]pyridine-3-carboxamide (PubChem CID 147664571) has the molecular formula C30H24F9N3O3 and a molecular weight of 645.52 g/mol. Its IUPAC name is 5-[3-[4-fluoro-3,3-bis(fluoromethyl)butanoyl]phenyl]-2-(4-fluorophenyl)-N-methyl-6-(2,2,3,3,3-pentafluoropropylamino)furo[2,3-b]pyridine-3-carboxamide.
| Compound Name | 5-[3-[4-fluoro-3,3-bis(fluoromethyl)butanoyl]phenyl]-2-(4-fluorophenyl)-N-methyl-6-(2,2,3,3,3-pentafluoropropylamino)furo[2,3-b]pyridine-3-carboxamide |
|---|---|
| PubChem CID | 147664571 |
| Molecular Formula | C30H24F9N3O3 |
| Molecular Weight | 645.52 g/mol |
| Exact Mass | 645.17 |
| IUPAC Name | 5-[3-[4-fluoro-3,3-bis(fluoromethyl)butanoyl]phenyl]-2-(4-fluorophenyl)-N-methyl-6-(2,2,3,3,3-pentafluoropropylamino)furo[2,3-b]pyridine-3-carboxamide |
| SMILES | CNC(=O)c1c(-c2ccc(F)cc2)oc2nc(NCC(F)(F)C(F)(F)F)c(-c3cccc(C(=O)CC(CF)(CF)CF)c3)cc12 |
| InChI | InChI=1S/C30H24F9N3O3/c1-40-26(44)23-21-10-20(17-3-2-4-18(9-17)22(43)11-28(12-31,13-32)14-33)25(41-15-29(35,36)30(37,38)39)42-27(21)45-24(23)16-5-7-19(34)8-6-16/h2-10H,11-15H2,1H3,(H,40,44)(H,41,42) |
| InChIKey | GMASKCBRIAAOMR-UHFFFAOYSA-N |
| XLogP | 7.74 |
| TPSA | 84.23 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 645.52 |
| LogP ≤ 5 | 7.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|