C20H18N4O4S — CID 147671928
6-[[6-(3-ethylsulfonylanilino)pyrimidin-4-yl]amino]-3H-1-benzofuran-2-one (PubChem CID 147671928) has the molecular formula C20H18N4O4S and a molecular weight of 410.46 g/mol. Its IUPAC name is 6-[[6-(3-ethylsulfonylanilino)pyrimidin-4-yl]amino]-3H-1-benzofuran-2-one.
| Compound Name | 6-[[6-(3-ethylsulfonylanilino)pyrimidin-4-yl]amino]-3H-1-benzofuran-2-one |
|---|---|
| PubChem CID | 147671928 |
| Molecular Formula | C20H18N4O4S |
| Molecular Weight | 410.46 g/mol |
| Exact Mass | 410.10 |
| IUPAC Name | 6-[[6-(3-ethylsulfonylanilino)pyrimidin-4-yl]amino]-3H-1-benzofuran-2-one |
| SMILES | CCS(=O)(=O)c1cccc(Nc2cc(Nc3ccc4c(c3)OC(=O)C4)ncn2)c1 |
| InChI | InChI=1S/C20H18N4O4S/c1-2-29(26,27)16-5-3-4-14(9-16)23-18-11-19(22-12-21-18)24-15-7-6-13-8-20(25)28-17(13)10-15/h3-7,9-12H,2,8H2,1H3,(H2,21,22,23,24) |
| InChIKey | GNKHWNPNMYVEMH-UHFFFAOYSA-N |
| XLogP | 3.22 |
| TPSA | 110.28 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.46 |
| LogP ≤ 5 | 3.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|