C22H30IN2O6S- — CID 147677735
2-(2-ethoxyethoxy)ethyl [(6R)-3,3-dimethyl-7-oxo-6-[(2-phenylacetyl)amino]-4-thia-1-azabicyclo[3.2.0]heptan-2-yl]iodanuidylformate (PubChem CID 147677735) has the molecular formula C22H30IN2O6S- and a molecular weight of 577.46 g/mol. Its IUPAC name is 2-(2-ethoxyethoxy)ethyl [(6R)-3,3-dimethyl-7-oxo-6-[(2-phenylacetyl)amino]-4-thia-1-azabicyclo[3.2.0]heptan-2-yl]iodanuidylformate.
| Compound Name | 2-(2-ethoxyethoxy)ethyl [(6R)-3,3-dimethyl-7-oxo-6-[(2-phenylacetyl)amino]-4-thia-1-azabicyclo[3.2.0]heptan-2-yl]iodanuidylformate |
|---|---|
| PubChem CID | 147677735 |
| Molecular Formula | C22H30IN2O6S- |
| Molecular Weight | 577.46 g/mol |
| Exact Mass | 577.09 |
| IUPAC Name | 2-(2-ethoxyethoxy)ethyl [(6R)-3,3-dimethyl-7-oxo-6-[(2-phenylacetyl)amino]-4-thia-1-azabicyclo[3.2.0]heptan-2-yl]iodanuidylformate |
| SMILES | CCOCCOCCOC(=O)[I-]C1N2C(=O)[C@@H](NC(=O)Cc3ccccc3)C2SC1(C)C |
| InChI | InChI=1S/C22H30IN2O6S/c1-4-29-10-11-30-12-13-31-21(28)23-20-22(2,3)32-19-17(18(27)25(19)20)24-16(26)14-15-8-6-5-7-9-15/h5-9,17,19-20H,4,10-14H2,1-3H3,(H,24,26)/q-1/t17-,19?,20?/m1/s1 |
| InChIKey | VOCSXWTVHHFHDH-QHGAOEGBSA-N |
| XLogP | -0.99 |
| TPSA | 94.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 577.46 |
| LogP ≤ 5 | -0.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'acid_halide', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'N-C-halo', 'substructure': 'N/A'} |
|---|