C23H23FIN2O4S- — CID 149405704
(2-fluorophenyl)methyl [(6R)-3,3-dimethyl-7-oxo-6-[(2-phenylacetyl)amino]-4-thia-1-azabicyclo[3.2.0]heptan-2-yl]iodanuidylformate (PubChem CID 149405704) has the molecular formula C23H23FIN2O4S- and a molecular weight of 569.42 g/mol. Its IUPAC name is (2-fluorophenyl)methyl [(6R)-3,3-dimethyl-7-oxo-6-[(2-phenylacetyl)amino]-4-thia-1-azabicyclo[3.2.0]heptan-2-yl]iodanuidylformate.
| Compound Name | (2-fluorophenyl)methyl [(6R)-3,3-dimethyl-7-oxo-6-[(2-phenylacetyl)amino]-4-thia-1-azabicyclo[3.2.0]heptan-2-yl]iodanuidylformate |
|---|---|
| PubChem CID | 149405704 |
| Molecular Formula | C23H23FIN2O4S- |
| Molecular Weight | 569.42 g/mol |
| Exact Mass | 569.04 |
| IUPAC Name | (2-fluorophenyl)methyl [(6R)-3,3-dimethyl-7-oxo-6-[(2-phenylacetyl)amino]-4-thia-1-azabicyclo[3.2.0]heptan-2-yl]iodanuidylformate |
| SMILES | CC1(C)SC2[C@H](NC(=O)Cc3ccccc3)C(=O)N2C1[I-]C(=O)OCc1ccccc1F |
| InChI | InChI=1S/C23H23FIN2O4S/c1-23(2)21(25-22(30)31-13-15-10-6-7-11-16(15)24)27-19(29)18(20(27)32-23)26-17(28)12-14-8-4-3-5-9-14/h3-11,18,20-21H,12-13H2,1-2H3,(H,26,28)/q-1/t18-,20?,21?/m1/s1 |
| InChIKey | VSXLYBZGKANQMQ-KMFTYDHNSA-N |
| XLogP | 0.30 |
| TPSA | 75.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 569.42 |
| LogP ≤ 5 | 0.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'acid_halide', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'N-C-halo', 'substructure': 'N/A'} |
|---|