C22H20Cl2N2O2S — CID 147682651
(3S,3'R,3'aR,6'aR)-6-chloro-3'-(4-chlorothiophen-2-yl)-1'-(cyclopropylmethyl)spiro[1H-indole-3,2'-3a,5,6,6a-tetrahydro-3H-cyclopenta[b]pyrrole]-2,4'-dione (PubChem CID 147682651) has the molecular formula C22H20Cl2N2O2S and a molecular weight of 447.39 g/mol. Its IUPAC name is (3S,3'R,3'aR,6'aR)-6-chloro-3'-(4-chlorothiophen-2-yl)-1'-(cyclopropylmethyl)spiro[1H-indole-3,2'-3a,5,6,6a-tetrahydro-3H-cyclopenta[b]pyrrole]-2,4'-dione.
| Compound Name | (3S,3'R,3'aR,6'aR)-6-chloro-3'-(4-chlorothiophen-2-yl)-1'-(cyclopropylmethyl)spiro[1H-indole-3,2'-3a,5,6,6a-tetrahydro-3H-cyclopenta[b]pyrrole]-2,4'-dione |
|---|---|
| PubChem CID | 147682651 |
| Molecular Formula | C22H20Cl2N2O2S |
| Molecular Weight | 447.39 g/mol |
| Exact Mass | 446.06 |
| IUPAC Name | (3S,3'R,3'aR,6'aR)-6-chloro-3'-(4-chlorothiophen-2-yl)-1'-(cyclopropylmethyl)spiro[1H-indole-3,2'-3a,5,6,6a-tetrahydro-3H-cyclopenta[b]pyrrole]-2,4'-dione |
| SMILES | O=C1CC[C@@H]2[C@H]1[C@@H](c1cc(Cl)cs1)[C@]1(C(=O)Nc3cc(Cl)ccc31)N2CC1CC1 |
| InChI | InChI=1S/C22H20Cl2N2O2S/c23-12-3-4-14-15(7-12)25-21(28)22(14)20(18-8-13(24)10-29-18)19-16(5-6-17(19)27)26(22)9-11-1-2-11/h3-4,7-8,10-11,16,19-20H,1-2,5-6,9H2,(H,25,28)/t16-,19-,20-,22-/m1/s1 |
| InChIKey | GPKNMFYDZNLBCZ-KREFBHGWSA-N |
| XLogP | 5.06 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 447.39 |
| LogP ≤ 5 | 5.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |