About 2-methyl-5-prop-1-en-2-yl-2,3-dihydrothiophene
2-methyl-5-prop-1-en-2-yl-2,3-dihydrothiophene (PubChem CID 147683600) has the molecular formula C8H12S
and a molecular weight of 140.25 g/mol. Its IUPAC name is 2-methyl-5-prop-1-en-2-yl-2,3-dihydrothiophene.
Analyze 2-methyl-5-prop-1-en-2-yl-2,3-dihydrothiophene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-methyl-5-prop-1-en-2-yl-2,3-dihydrothiophene?
The IUPAC name of 2-methyl-5-prop-1-en-2-yl-2,3-dihydrothiophene (CID 147683600) is 2-methyl-5-prop-1-en-2-yl-2,3-dihydrothiophene.
What is the SMILES notation for 2-methyl-5-prop-1-en-2-yl-2,3-dihydrothiophene?
The canonical SMILES for 2-methyl-5-prop-1-en-2-yl-2,3-dihydrothiophene is C=C(C)C1=CCC(C)S1.
What is the InChIKey of 2-methyl-5-prop-1-en-2-yl-2,3-dihydrothiophene?
The InChIKey is GPOZNFFTPYQXEA-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H12S/c1-6(2)8-5-4-7(3)9-8/h5,7H,1,4H2,2-3H3.
What are the key properties of 2-methyl-5-prop-1-en-2-yl-2,3-dihydrothiophene?
2-methyl-5-prop-1-en-2-yl-2,3-dihydrothiophene has a molecular weight of 140.25 g/mol, XLogP of 2.97, 1 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 2-methyl-5-prop-1-en-2-yl-2,3-dihydrothiophene is sourced from PubChem (CID 147683600), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).