C5H7BrS — CID 148727761
(2R)-5-bromo-2-methyl-2,3-dihydrothiophene (PubChem CID 148727761) has the molecular formula C5H7BrS and a molecular weight of 179.08 g/mol. Its IUPAC name is (2R)-5-bromo-2-methyl-2,3-dihydrothiophene.
| Compound Name | (2R)-5-bromo-2-methyl-2,3-dihydrothiophene |
|---|---|
| PubChem CID | 148727761 |
| Molecular Formula | C5H7BrS |
| Molecular Weight | 179.08 g/mol |
| Exact Mass | 177.95 |
| IUPAC Name | (2R)-5-bromo-2-methyl-2,3-dihydrothiophene |
| SMILES | C[C@@H]1CC=C(Br)S1 |
| InChI | InChI=1S/C5H7BrS/c1-4-2-3-5(6)7-4/h3-4H,2H2,1H3/t4-/m1/s1 |
| InChIKey | OAIOOYDCWAKQFX-SCSAIBSYSA-N |
| XLogP | 2.75 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 7 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 179.08 |
| LogP ≤ 5 | 2.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |