C7H11NO — CID 147688389
3-amino-3-methylcyclohexa-1,5-dien-1-ol (PubChem CID 147688389) has the molecular formula C7H11NO and a molecular weight of 125.17 g/mol. Its IUPAC name is 3-amino-3-methylcyclohexa-1,5-dien-1-ol.
| Compound Name | 3-amino-3-methylcyclohexa-1,5-dien-1-ol |
|---|---|
| PubChem CID | 147688389 |
| Molecular Formula | C7H11NO |
| Molecular Weight | 125.17 g/mol |
| Exact Mass | 125.08 |
| IUPAC Name | 3-amino-3-methylcyclohexa-1,5-dien-1-ol |
| SMILES | CC1(N)C=C(O)C=CC1 |
| InChI | InChI=1S/C7H11NO/c1-7(8)4-2-3-6(9)5-7/h2-3,5,9H,4,8H2,1H3 |
| InChIKey | GQMCHMPVLPNTPM-UHFFFAOYSA-N |
| XLogP | 1.11 |
| TPSA | 46.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 9 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 125.17 |
| LogP ≤ 5 | 1.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |