C22H22FN2S+ — CID 147691518
7-fluoro-3-methyl-4-(2-methylphenyl)-6-(2-methylpropyl)-[1]benzothiolo[3,2-d]pyrimidin-3-ium (PubChem CID 147691518) has the molecular formula C22H22FN2S+ and a molecular weight of 365.50 g/mol. Its IUPAC name is 7-fluoro-3-methyl-4-(2-methylphenyl)-6-(2-methylpropyl)-[1]benzothiolo[3,2-d]pyrimidin-3-ium.
| Compound Name | 7-fluoro-3-methyl-4-(2-methylphenyl)-6-(2-methylpropyl)-[1]benzothiolo[3,2-d]pyrimidin-3-ium |
|---|---|
| PubChem CID | 147691518 |
| Molecular Formula | C22H22FN2S+ |
| Molecular Weight | 365.50 g/mol |
| Exact Mass | 365.15 |
| IUPAC Name | 7-fluoro-3-methyl-4-(2-methylphenyl)-6-(2-methylpropyl)-[1]benzothiolo[3,2-d]pyrimidin-3-ium |
| SMILES | Cc1ccccc1-c1c2sc3c(CC(C)C)c(F)ccc3c2nc[n+]1C |
| InChI | InChI=1S/C22H22FN2S/c1-13(2)11-17-18(23)10-9-16-19-22(26-21(16)17)20(25(4)12-24-19)15-8-6-5-7-14(15)3/h5-10,12-13H,11H2,1-4H3/q+1 |
| InChIKey | ALWUZFGPLDRHJW-UHFFFAOYSA-N |
| XLogP | 5.59 |
| TPSA | 16.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.50 |
| LogP ≤ 5 | 5.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|