C16H11N3S — CID 21137158
N-phenyl-[1]benzothiolo[3,2-d]pyrimidin-4-amine (PubChem CID 21137158) has the molecular formula C16H11N3S and a molecular weight of 277.35 g/mol. Its IUPAC name is N-phenyl-[1]benzothiolo[3,2-d]pyrimidin-4-amine.
| Compound Name | N-phenyl-[1]benzothiolo[3,2-d]pyrimidin-4-amine |
|---|---|
| PubChem CID | 21137158 |
| Molecular Formula | C16H11N3S |
| Molecular Weight | 277.35 g/mol |
| Exact Mass | 277.07 |
| IUPAC Name | N-phenyl-[1]benzothiolo[3,2-d]pyrimidin-4-amine |
| SMILES | c1ccc(Nc2ncnc3c2sc2ccccc23)cc1 |
| InChI | InChI=1S/C16H11N3S/c1-2-6-11(7-3-1)19-16-15-14(17-10-18-16)12-8-4-5-9-13(12)20-15/h1-10H,(H,17,18,19) |
| InChIKey | LTGQZQQOZBAZJZ-UHFFFAOYSA-N |
| XLogP | 4.59 |
| TPSA | 37.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 277.35 |
| LogP ≤ 5 | 4.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |