C23H26F3N3O3 — CID 147693982
(4S)-5-hydroxy-5-methyl-4-phenyl-1-[3-(4,4,4-trifluorobutoxy)-1H-pyrazolo[4,3-c]pyridin-6-yl]hexan-2-one (PubChem CID 147693982) has the molecular formula C23H26F3N3O3 and a molecular weight of 449.47 g/mol. Its IUPAC name is (4S)-5-hydroxy-5-methyl-4-phenyl-1-[3-(4,4,4-trifluorobutoxy)-1H-pyrazolo[4,3-c]pyridin-6-yl]hexan-2-one.
| Compound Name | (4S)-5-hydroxy-5-methyl-4-phenyl-1-[3-(4,4,4-trifluorobutoxy)-1H-pyrazolo[4,3-c]pyridin-6-yl]hexan-2-one |
|---|---|
| PubChem CID | 147693982 |
| Molecular Formula | C23H26F3N3O3 |
| Molecular Weight | 449.47 g/mol |
| Exact Mass | 449.19 |
| IUPAC Name | (4S)-5-hydroxy-5-methyl-4-phenyl-1-[3-(4,4,4-trifluorobutoxy)-1H-pyrazolo[4,3-c]pyridin-6-yl]hexan-2-one |
| SMILES | CC(C)(O)[C@@H](CC(=O)Cc1cc2[nH]nc(OCCCC(F)(F)F)c2cn1)c1ccccc1 |
| InChI | InChI=1S/C23H26F3N3O3/c1-22(2,31)19(15-7-4-3-5-8-15)13-17(30)11-16-12-20-18(14-27-16)21(29-28-20)32-10-6-9-23(24,25)26/h3-5,7-8,12,14,19,31H,6,9-11,13H2,1-2H3,(H,28,29)/t19-/m0/s1 |
| InChIKey | GRNGISOXFVYOAS-IBGZPJMESA-N |
| XLogP | 4.74 |
| TPSA | 88.10 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 449.47 |
| LogP ≤ 5 | 4.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|