C21H24F3N3O4S — CID 147698869
1-[2-(oxan-2-yl)-5-propylsulfonylphenyl]-3-[4-(trifluoromethyl)-2-pyridinyl]urea (PubChem CID 147698869) has the molecular formula C21H24F3N3O4S and a molecular weight of 471.50 g/mol. Its IUPAC name is 1-[2-(oxan-2-yl)-5-propylsulfonylphenyl]-3-[4-(trifluoromethyl)-2-pyridinyl]urea.
| Compound Name | 1-[2-(oxan-2-yl)-5-propylsulfonylphenyl]-3-[4-(trifluoromethyl)-2-pyridinyl]urea |
|---|---|
| PubChem CID | 147698869 |
| Molecular Formula | C21H24F3N3O4S |
| Molecular Weight | 471.50 g/mol |
| Exact Mass | 471.14 |
| IUPAC Name | 1-[2-(oxan-2-yl)-5-propylsulfonylphenyl]-3-[4-(trifluoromethyl)-2-pyridinyl]urea |
| SMILES | CCCS(=O)(=O)c1ccc(C2CCCCO2)c(NC(=O)Nc2cc(C(F)(F)F)ccn2)c1 |
| InChI | InChI=1S/C21H24F3N3O4S/c1-2-11-32(29,30)15-6-7-16(18-5-3-4-10-31-18)17(13-15)26-20(28)27-19-12-14(8-9-25-19)21(22,23)24/h6-9,12-13,18H,2-5,10-11H2,1H3,(H2,25,26,27,28) |
| InChIKey | GSLOLORVZHAWDN-UHFFFAOYSA-N |
| XLogP | 5.17 |
| TPSA | 97.39 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 471.50 |
| LogP ≤ 5 | 5.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |