C20H15FO6S — CID 147712414
4-[[3-(5-fluoro-2-hydroxyphenyl)phenyl]sulfonylmethyl]-2-hydroxybenzoic acid (PubChem CID 147712414) has the molecular formula C20H15FO6S and a molecular weight of 402.40 g/mol. Its IUPAC name is 4-[[3-(5-fluoro-2-hydroxyphenyl)phenyl]sulfonylmethyl]-2-hydroxybenzoic acid.
| Compound Name | 4-[[3-(5-fluoro-2-hydroxyphenyl)phenyl]sulfonylmethyl]-2-hydroxybenzoic acid |
|---|---|
| PubChem CID | 147712414 |
| Molecular Formula | C20H15FO6S |
| Molecular Weight | 402.40 g/mol |
| Exact Mass | 402.06 |
| IUPAC Name | 4-[[3-(5-fluoro-2-hydroxyphenyl)phenyl]sulfonylmethyl]-2-hydroxybenzoic acid |
| SMILES | O=C(O)c1ccc(CS(=O)(=O)c2cccc(-c3cc(F)ccc3O)c2)cc1O |
| InChI | InChI=1S/C20H15FO6S/c21-14-5-7-18(22)17(10-14)13-2-1-3-15(9-13)28(26,27)11-12-4-6-16(20(24)25)19(23)8-12/h1-10,22-23H,11H2,(H,24,25) |
| InChIKey | GUYXJTTWYZZJFU-UHFFFAOYSA-N |
| XLogP | 3.58 |
| TPSA | 111.90 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.40 |
| LogP ≤ 5 | 3.58 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |