C20H21F3O5S — CID 11962558
3-tert-butyl-2-hydroxy-6-methyl-5-[[2-(trifluoromethyl)phenyl]methylsulfonyl]benzoic acid (PubChem CID 11962558) has the molecular formula C20H21F3O5S and a molecular weight of 430.44 g/mol. Its IUPAC name is 3-tert-butyl-2-hydroxy-6-methyl-5-[[2-(trifluoromethyl)phenyl]methylsulfonyl]benzoic acid.
| Compound Name | 3-tert-butyl-2-hydroxy-6-methyl-5-[[2-(trifluoromethyl)phenyl]methylsulfonyl]benzoic acid |
|---|---|
| PubChem CID | 11962558 |
| Molecular Formula | C20H21F3O5S |
| Molecular Weight | 430.44 g/mol |
| Exact Mass | 430.11 |
| IUPAC Name | 3-tert-butyl-2-hydroxy-6-methyl-5-[[2-(trifluoromethyl)phenyl]methylsulfonyl]benzoic acid |
| SMILES | Cc1c(S(=O)(=O)Cc2ccccc2C(F)(F)F)cc(C(C)(C)C)c(O)c1C(=O)O |
| InChI | InChI=1S/C20H21F3O5S/c1-11-15(9-14(19(2,3)4)17(24)16(11)18(25)26)29(27,28)10-12-7-5-6-8-13(12)20(21,22)23/h5-9,24H,10H2,1-4H3,(H,25,26) |
| InChIKey | STOMIRHERCGZMF-UHFFFAOYSA-N |
| XLogP | 4.69 |
| TPSA | 91.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.44 |
| LogP ≤ 5 | 4.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |