C30H35FO3S — CID 46928817
methyl 3-decyl-5-(4-fluorophenyl)sulfanyl-2-hydroxy-6-phenylbenzoate (PubChem CID 46928817) has the molecular formula C30H35FO3S and a molecular weight of 494.67 g/mol. Its IUPAC name is methyl 3-decyl-5-(4-fluorophenyl)sulfanyl-2-hydroxy-6-phenylbenzoate.
| Compound Name | methyl 3-decyl-5-(4-fluorophenyl)sulfanyl-2-hydroxy-6-phenylbenzoate |
|---|---|
| PubChem CID | 46928817 |
| Molecular Formula | C30H35FO3S |
| Molecular Weight | 494.67 g/mol |
| Exact Mass | 494.23 |
| IUPAC Name | methyl 3-decyl-5-(4-fluorophenyl)sulfanyl-2-hydroxy-6-phenylbenzoate |
| SMILES | CCCCCCCCCCc1cc(Sc2ccc(F)cc2)c(-c2ccccc2)c(C(=O)OC)c1O |
| InChI | InChI=1S/C30H35FO3S/c1-3-4-5-6-7-8-9-11-16-23-21-26(35-25-19-17-24(31)18-20-25)27(22-14-12-10-13-15-22)28(29(23)32)30(33)34-2/h10,12-15,17-21,32H,3-9,11,16H2,1-2H3 |
| InChIKey | AVTUYOGGEWKGPF-UHFFFAOYSA-N |
| XLogP | 8.82 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 494.67 |
| LogP ≤ 5 | 8.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|