C16H16O5S — CID 102035254
methyl 6-hydroxy-2-methyl-3-(4-methylphenyl)sulfonylbenzoate (PubChem CID 102035254) has the molecular formula C16H16O5S and a molecular weight of 320.37 g/mol. Its IUPAC name is methyl 6-hydroxy-2-methyl-3-(4-methylphenyl)sulfonylbenzoate.
| Compound Name | methyl 6-hydroxy-2-methyl-3-(4-methylphenyl)sulfonylbenzoate |
|---|---|
| PubChem CID | 102035254 |
| Molecular Formula | C16H16O5S |
| Molecular Weight | 320.37 g/mol |
| Exact Mass | 320.07 |
| IUPAC Name | methyl 6-hydroxy-2-methyl-3-(4-methylphenyl)sulfonylbenzoate |
| SMILES | COC(=O)c1c(O)ccc(S(=O)(=O)c2ccc(C)cc2)c1C |
| InChI | InChI=1S/C16H16O5S/c1-10-4-6-12(7-5-10)22(19,20)14-9-8-13(17)15(11(14)2)16(18)21-3/h4-9,17H,1-3H3 |
| InChIKey | VHXLFKNOGSMNOD-UHFFFAOYSA-N |
| XLogP | 2.63 |
| TPSA | 80.67 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.37 |
| LogP ≤ 5 | 2.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |