C32H44FN4O2+ — CID 147742732
triethyl-[[2-(4-fluorobenzoyl)imino-1-[4-(propan-2-ylcarbamoyl)cyclohexyl]-3H-indol-6-yl]methyl]azanium (PubChem CID 147742732) has the molecular formula C32H44FN4O2+ and a molecular weight of 535.73 g/mol. Its IUPAC name is triethyl-[[2-(4-fluorobenzoyl)imino-1-[4-(propan-2-ylcarbamoyl)cyclohexyl]-3H-indol-6-yl]methyl]azanium.
| Compound Name | triethyl-[[2-(4-fluorobenzoyl)imino-1-[4-(propan-2-ylcarbamoyl)cyclohexyl]-3H-indol-6-yl]methyl]azanium |
|---|---|
| PubChem CID | 147742732 |
| Molecular Formula | C32H44FN4O2+ |
| Molecular Weight | 535.73 g/mol |
| Exact Mass | 535.34 |
| IUPAC Name | triethyl-[[2-(4-fluorobenzoyl)imino-1-[4-(propan-2-ylcarbamoyl)cyclohexyl]-3H-indol-6-yl]methyl]azanium |
| SMILES | CC[N+](CC)(CC)Cc1ccc2c(c1)N(C1CCC(C(=O)NC(C)C)CC1)/C(=N/C(=O)c1ccc(F)cc1)C2 |
| InChI | InChI=1S/C32H43FN4O2/c1-6-37(7-2,8-3)21-23-9-10-26-20-30(35-32(39)24-11-15-27(33)16-12-24)36(29(26)19-23)28-17-13-25(14-18-28)31(38)34-22(4)5/h9-12,15-16,19,22,25,28H,6-8,13-14,17-18,20-21H2,1-5H3/p+1/b35-30+ |
| InChIKey | HAQSEMWJGHMTNE-WUZYOQQESA-O |
| XLogP | 5.89 |
| TPSA | 61.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 535.73 |
| LogP ≤ 5 | 5.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|