C25H25FO7S — CID 147744245
2-methoxybutyl 4-[[3-(5-fluoro-2-hydroxyphenyl)phenyl]sulfonylmethyl]-2-hydroxybenzoate (PubChem CID 147744245) has the molecular formula C25H25FO7S and a molecular weight of 488.53 g/mol. Its IUPAC name is 2-methoxybutyl 4-[[3-(5-fluoro-2-hydroxyphenyl)phenyl]sulfonylmethyl]-2-hydroxybenzoate.
| Compound Name | 2-methoxybutyl 4-[[3-(5-fluoro-2-hydroxyphenyl)phenyl]sulfonylmethyl]-2-hydroxybenzoate |
|---|---|
| PubChem CID | 147744245 |
| Molecular Formula | C25H25FO7S |
| Molecular Weight | 488.53 g/mol |
| Exact Mass | 488.13 |
| IUPAC Name | 2-methoxybutyl 4-[[3-(5-fluoro-2-hydroxyphenyl)phenyl]sulfonylmethyl]-2-hydroxybenzoate |
| SMILES | CCC(COC(=O)c1ccc(CS(=O)(=O)c2cccc(-c3cc(F)ccc3O)c2)cc1O)OC |
| InChI | InChI=1S/C25H25FO7S/c1-3-19(32-2)14-33-25(29)21-9-7-16(11-24(21)28)15-34(30,31)20-6-4-5-17(12-20)22-13-18(26)8-10-23(22)27/h4-13,19,27-28H,3,14-15H2,1-2H3 |
| InChIKey | HAYITUHPNSZHID-UHFFFAOYSA-N |
| XLogP | 4.46 |
| TPSA | 110.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 488.53 |
| LogP ≤ 5 | 4.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |