C7H11N3O — CID 147755232
4,6-dimethyl-5-(methylamino)-1H-pyrimidin-2-one (PubChem CID 147755232) has the molecular formula C7H11N3O and a molecular weight of 153.18 g/mol. Its IUPAC name is 4,6-dimethyl-5-(methylamino)-1H-pyrimidin-2-one.
| Compound Name | 4,6-dimethyl-5-(methylamino)-1H-pyrimidin-2-one |
|---|---|
| PubChem CID | 147755232 |
| Molecular Formula | C7H11N3O |
| Molecular Weight | 153.18 g/mol |
| Exact Mass | 153.09 |
| IUPAC Name | 4,6-dimethyl-5-(methylamino)-1H-pyrimidin-2-one |
| SMILES | CNc1c(C)nc(=O)[nH]c1C |
| InChI | InChI=1S/C7H11N3O/c1-4-6(8-3)5(2)10-7(11)9-4/h8H,1-3H3,(H,9,10,11) |
| InChIKey | HCZFFAQIZNPABD-UHFFFAOYSA-N |
| XLogP | 0.43 |
| TPSA | 57.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 153.18 |
| LogP ≤ 5 | 0.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |