C22H35ClFN3O4 — CID 147779172
N-[(2S)-4-[[2-(4-chloro-3-fluorocyclohexyl)oxyacetyl]amino]-2-hydroxy-1-bicyclo[2.2.2]octanyl]piperidine-2-carboxamide (PubChem CID 147779172) has the molecular formula C22H35ClFN3O4 and a molecular weight of 459.99 g/mol. Its IUPAC name is N-[(2S)-4-[[2-(4-chloro-3-fluorocyclohexyl)oxyacetyl]amino]-2-hydroxy-1-bicyclo[2.2.2]octanyl]piperidine-2-carboxamide.
| Compound Name | N-[(2S)-4-[[2-(4-chloro-3-fluorocyclohexyl)oxyacetyl]amino]-2-hydroxy-1-bicyclo[2.2.2]octanyl]piperidine-2-carboxamide |
|---|---|
| PubChem CID | 147779172 |
| Molecular Formula | C22H35ClFN3O4 |
| Molecular Weight | 459.99 g/mol |
| Exact Mass | 459.23 |
| IUPAC Name | N-[(2S)-4-[[2-(4-chloro-3-fluorocyclohexyl)oxyacetyl]amino]-2-hydroxy-1-bicyclo[2.2.2]octanyl]piperidine-2-carboxamide |
| SMILES | O=C(COC1CCC(Cl)C(F)C1)NC12CCC(NC(=O)C3CCCCN3)(CC1)[C@@H](O)C2 |
| InChI | InChI=1S/C22H35ClFN3O4/c23-15-5-4-14(11-16(15)24)31-13-19(29)26-21-6-8-22(9-7-21,18(28)12-21)27-20(30)17-3-1-2-10-25-17/h14-18,25,28H,1-13H2,(H,26,29)(H,27,30)/t14?,15?,16?,17?,18-,21?,22?/m0/s1 |
| InChIKey | CWTQLUBUURGVOW-CXJCAFDZSA-N |
| XLogP | 1.69 |
| TPSA | 99.69 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 459.99 |
| LogP ≤ 5 | 1.69 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|