C25H39ClF2N4O4 — CID 147611675
N-[(2S)-4-[[2-(4-chloro-3-fluorocyclohexyl)oxyacetyl]amino]-2-hydroxy-1-bicyclo[2.2.2]octanyl]-6-fluoro-1,2,3,4,4a,5,6,7,8,8a-decahydroquinoxaline-2-carboxamide (PubChem CID 147611675) has the molecular formula C25H39ClF2N4O4 and a molecular weight of 533.06 g/mol. Its IUPAC name is N-[(2S)-4-[[2-(4-chloro-3-fluorocyclohexyl)oxyacetyl]amino]-2-hydroxy-1-bicyclo[2.2.2]octanyl]-6-fluoro-1,2,3,4,4a,5,6,7,8,8a-decahydroquinoxaline-2-carboxamide.
| Compound Name | N-[(2S)-4-[[2-(4-chloro-3-fluorocyclohexyl)oxyacetyl]amino]-2-hydroxy-1-bicyclo[2.2.2]octanyl]-6-fluoro-1,2,3,4,4a,5,6,7,8,8a-decahydroquinoxaline-2-carboxamide |
|---|---|
| PubChem CID | 147611675 |
| Molecular Formula | C25H39ClF2N4O4 |
| Molecular Weight | 533.06 g/mol |
| Exact Mass | 532.26 |
| IUPAC Name | N-[(2S)-4-[[2-(4-chloro-3-fluorocyclohexyl)oxyacetyl]amino]-2-hydroxy-1-bicyclo[2.2.2]octanyl]-6-fluoro-1,2,3,4,4a,5,6,7,8,8a-decahydroquinoxaline-2-carboxamide |
| SMILES | O=C(COC1CCC(Cl)C(F)C1)NC12CCC(NC(=O)C3CNC4CC(F)CCC4N3)(CC1)[C@@H](O)C2 |
| InChI | InChI=1S/C25H39ClF2N4O4/c26-16-3-2-15(10-17(16)28)36-13-22(34)31-24-5-7-25(8-6-24,21(33)11-24)32-23(35)20-12-29-19-9-14(27)1-4-18(19)30-20/h14-21,29-30,33H,1-13H2,(H,31,34)(H,32,35)/t14?,15?,16?,17?,18?,19?,20?,21-,24?,25?/m0/s1 |
| InChIKey | FJNBTQPNDHINQZ-RKVIIZAFSA-N |
| XLogP | 1.37 |
| TPSA | 111.72 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 533.06 |
| LogP ≤ 5 | 1.37 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|