C25H40ClFN4O4 — CID 155633916
N-[4-[[2-(4-chloro-3-fluorocyclohexyl)oxyacetyl]amino]-2-hydroxy-1-bicyclo[2.2.2]octanyl]-1,2,3,4,4a,5,6,7,8,8a-decahydroquinoxaline-2-carboxamide (PubChem CID 155633916) has the molecular formula C25H40ClFN4O4 and a molecular weight of 515.07 g/mol. Its IUPAC name is N-[4-[[2-(4-chloro-3-fluorocyclohexyl)oxyacetyl]amino]-2-hydroxy-1-bicyclo[2.2.2]octanyl]-1,2,3,4,4a,5,6,7,8,8a-decahydroquinoxaline-2-carboxamide.
| Compound Name | N-[4-[[2-(4-chloro-3-fluorocyclohexyl)oxyacetyl]amino]-2-hydroxy-1-bicyclo[2.2.2]octanyl]-1,2,3,4,4a,5,6,7,8,8a-decahydroquinoxaline-2-carboxamide |
|---|---|
| PubChem CID | 155633916 |
| Molecular Formula | C25H40ClFN4O4 |
| Molecular Weight | 515.07 g/mol |
| Exact Mass | 514.27 |
| IUPAC Name | N-[4-[[2-(4-chloro-3-fluorocyclohexyl)oxyacetyl]amino]-2-hydroxy-1-bicyclo[2.2.2]octanyl]-1,2,3,4,4a,5,6,7,8,8a-decahydroquinoxaline-2-carboxamide |
| SMILES | O=C(COC1CCC(Cl)C(F)C1)NC12CCC(NC(=O)C3CNC4CCCCC4N3)(CC1)C(O)C2 |
| InChI | InChI=1S/C25H40ClFN4O4/c26-16-6-5-15(11-17(16)27)35-14-22(33)30-24-7-9-25(10-8-24,21(32)12-24)31-23(34)20-13-28-18-3-1-2-4-19(18)29-20/h15-21,28-29,32H,1-14H2,(H,30,33)(H,31,34) |
| InChIKey | OLHPHEBKFZPZRD-UHFFFAOYSA-N |
| XLogP | 1.42 |
| TPSA | 111.72 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 515.07 |
| LogP ≤ 5 | 1.42 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|