C29H27N5O3S — CID 1477906
(1S)-6-[3-(2,5-dimethylpyrrol-1-yl)thiophen-2-yl]-18,19-dimethoxy-4,5,9,13-tetrazapentacyclo[11.8.0.03,11.04,8.016,21]henicosa-3(11),5,7,9,16,18,20-heptaen-12-one (PubChem CID 1477906) has the molecular formula C29H27N5O3S and a molecular weight of 525.63 g/mol. Its IUPAC name is (1S)-6-[3-(2,5-dimethylpyrrol-1-yl)thiophen-2-yl]-18,19-dimethoxy-4,5,9,13-tetrazapentacyclo[11.8.0.03,11.04,8.016,21]henicosa-3(11),5,7,9,16,18,20-heptaen-12-one.
| Compound Name | (1S)-6-[3-(2,5-dimethylpyrrol-1-yl)thiophen-2-yl]-18,19-dimethoxy-4,5,9,13-tetrazapentacyclo[11.8.0.03,11.04,8.016,21]henicosa-3(11),5,7,9,16,18,20-heptaen-12-one |
|---|---|
| PubChem CID | 1477906 |
| Molecular Formula | C29H27N5O3S |
| Molecular Weight | 525.63 g/mol |
| Exact Mass | 525.18 |
| IUPAC Name | (1S)-6-[3-(2,5-dimethylpyrrol-1-yl)thiophen-2-yl]-18,19-dimethoxy-4,5,9,13-tetrazapentacyclo[11.8.0.03,11.04,8.016,21]henicosa-3(11),5,7,9,16,18,20-heptaen-12-one |
| SMILES | COc1cc2c(cc1OC)[C@@H]1Cc3c(cnc4cc(-c5sccc5-n5c(C)ccc5C)nn34)C(=O)N1CC2 |
| InChI | InChI=1S/C29H27N5O3S/c1-16-5-6-17(2)33(16)22-8-10-38-28(22)21-13-27-30-15-20-24(34(27)31-21)14-23-19-12-26(37-4)25(36-3)11-18(19)7-9-32(23)29(20)35/h5-6,8,10-13,15,23H,7,9,14H2,1-4H3/t23-/m0/s1 |
| InChIKey | MEZPIUWICCKGKB-QHCPKHFHSA-N |
| XLogP | 5.18 |
| TPSA | 73.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 525.63 |
| LogP ≤ 5 | 5.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'pyrrole_E(5)', 'substructure': 'N/A'} |
|---|