C20H27N4O4S2+ — CID 147791967
CID 147791967 (PubChem CID 147791967) has the molecular formula C20H27N4O4S2+ and a molecular weight of 451.59 g/mol.
| Compound Name | CID 147791967 |
|---|---|
| PubChem CID | 147791967 |
| Molecular Formula | C20H27N4O4S2+ |
| Molecular Weight | 451.59 g/mol |
| Exact Mass | 451.15 |
| IUPAC Name | — |
| SMILES | Cc1ccc(NC(=O)Nc2nc(CCN[S+](C)(=O)O)cs2)c(C(=O)C2CCCC2)c1 |
| InChI | InChI=1S/C20H26N4O4S2/c1-13-7-8-17(16(11-13)18(25)14-5-3-4-6-14)23-19(26)24-20-22-15(12-29-20)9-10-21-30(2,27)28/h7-8,11-12,14H,3-6,9-10H2,1-2H3,(H3-,21,22,23,24,25,26,27,28)/p+1 |
| InChIKey | LBTGBXRZAZLPTD-UHFFFAOYSA-O |
| XLogP | 4.12 |
| TPSA | 120.42 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 451.59 |
| LogP ≤ 5 | 4.12 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'} |
|---|