C25H37N3O3SSi — CID 59732910
1-[4-[2-[tert-butyl(dimethyl)silyl]oxyethyl]-1,3-thiazol-2-yl]-3-[2-(cyclopentanecarbonyl)-4-methylphenyl]urea (PubChem CID 59732910) has the molecular formula C25H37N3O3SSi and a molecular weight of 487.74 g/mol. Its IUPAC name is 1-[4-[2-[tert-butyl(dimethyl)silyl]oxyethyl]-1,3-thiazol-2-yl]-3-[2-(cyclopentanecarbonyl)-4-methylphenyl]urea.
| Compound Name | 1-[4-[2-[tert-butyl(dimethyl)silyl]oxyethyl]-1,3-thiazol-2-yl]-3-[2-(cyclopentanecarbonyl)-4-methylphenyl]urea |
|---|---|
| PubChem CID | 59732910 |
| Molecular Formula | C25H37N3O3SSi |
| Molecular Weight | 487.74 g/mol |
| Exact Mass | 487.23 |
| IUPAC Name | 1-[4-[2-[tert-butyl(dimethyl)silyl]oxyethyl]-1,3-thiazol-2-yl]-3-[2-(cyclopentanecarbonyl)-4-methylphenyl]urea |
| SMILES | Cc1ccc(NC(=O)Nc2nc(CCO[Si](C)(C)C(C)(C)C)cs2)c(C(=O)C2CCCC2)c1 |
| InChI | InChI=1S/C25H37N3O3SSi/c1-17-11-12-21(20(15-17)22(29)18-9-7-8-10-18)27-23(30)28-24-26-19(16-32-24)13-14-31-33(5,6)25(2,3)4/h11-12,15-16,18H,7-10,13-14H2,1-6H3,(H2,26,27,28,30) |
| InChIKey | LNCXIJQJZPOSAC-UHFFFAOYSA-N |
| XLogP | 7.03 |
| TPSA | 80.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 487.74 |
| LogP ≤ 5 | 7.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|