C22H28N4O4S — CID 59732809
methyl 2-[2-[2-[[2-(cyclopentanecarbonyl)-4-methylphenyl]carbamoylamino]-1,3-thiazol-4-yl]ethylamino]acetate (PubChem CID 59732809) has the molecular formula C22H28N4O4S and a molecular weight of 444.56 g/mol. Its IUPAC name is methyl 2-[2-[2-[[2-(cyclopentanecarbonyl)-4-methylphenyl]carbamoylamino]-1,3-thiazol-4-yl]ethylamino]acetate.
| Compound Name | methyl 2-[2-[2-[[2-(cyclopentanecarbonyl)-4-methylphenyl]carbamoylamino]-1,3-thiazol-4-yl]ethylamino]acetate |
|---|---|
| PubChem CID | 59732809 |
| Molecular Formula | C22H28N4O4S |
| Molecular Weight | 444.56 g/mol |
| Exact Mass | 444.18 |
| IUPAC Name | methyl 2-[2-[2-[[2-(cyclopentanecarbonyl)-4-methylphenyl]carbamoylamino]-1,3-thiazol-4-yl]ethylamino]acetate |
| SMILES | COC(=O)CNCCc1csc(NC(=O)Nc2ccc(C)cc2C(=O)C2CCCC2)n1 |
| InChI | InChI=1S/C22H28N4O4S/c1-14-7-8-18(17(11-14)20(28)15-5-3-4-6-15)25-21(29)26-22-24-16(13-31-22)9-10-23-12-19(27)30-2/h7-8,11,13,15,23H,3-6,9-10,12H2,1-2H3,(H2,24,25,26,29) |
| InChIKey | CJEOZIQBURGNBR-UHFFFAOYSA-N |
| XLogP | 3.77 |
| TPSA | 109.42 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.56 |
| LogP ≤ 5 | 3.77 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|