C21H28O2 — CID 147798416
(4S,5S,8R)-8,12-dimethyl-11-methylidene-4-(4-methylpent-3-enyl)-2-oxatricyclo[7.3.1.05,13]trideca-1(12),9(13)-dien-10-one (PubChem CID 147798416) has the molecular formula C21H28O2 and a molecular weight of 312.45 g/mol. Its IUPAC name is (4S,5S,8R)-8,12-dimethyl-11-methylidene-4-(4-methylpent-3-enyl)-2-oxatricyclo[7.3.1.05,13]trideca-1(12),9(13)-dien-10-one.
| Compound Name | (4S,5S,8R)-8,12-dimethyl-11-methylidene-4-(4-methylpent-3-enyl)-2-oxatricyclo[7.3.1.05,13]trideca-1(12),9(13)-dien-10-one |
|---|---|
| PubChem CID | 147798416 |
| Molecular Formula | C21H28O2 |
| Molecular Weight | 312.45 g/mol |
| Exact Mass | 312.21 |
| IUPAC Name | (4S,5S,8R)-8,12-dimethyl-11-methylidene-4-(4-methylpent-3-enyl)-2-oxatricyclo[7.3.1.05,13]trideca-1(12),9(13)-dien-10-one |
| SMILES | C=C1C(=O)C2=C3C(=C1C)OC[C@@H](CCC=C(C)C)[C@@H]3CC[C@H]2C |
| InChI | InChI=1S/C21H28O2/c1-12(2)7-6-8-16-11-23-21-15(5)14(4)20(22)18-13(3)9-10-17(16)19(18)21/h7,13,16-17H,4,6,8-11H2,1-3,5H3/t13-,16-,17+/m1/s1 |
| InChIKey | HLAJLOCBHSQEOQ-XYPHTWIQSA-N |
| XLogP | 5.13 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.45 |
| LogP ≤ 5 | 5.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|