C11H18N2O6 — CID 14783060
5-[bis(2-hydroxyethylamino)methylidene]-2,2-dimethyl-1,3-dioxane-4,6-dione (PubChem CID 14783060) has the molecular formula C11H18N2O6 and a molecular weight of 274.27 g/mol. Its IUPAC name is 5-[bis(2-hydroxyethylamino)methylidene]-2,2-dimethyl-1,3-dioxane-4,6-dione.
| Compound Name | 5-[bis(2-hydroxyethylamino)methylidene]-2,2-dimethyl-1,3-dioxane-4,6-dione |
|---|---|
| PubChem CID | 14783060 |
| Molecular Formula | C11H18N2O6 |
| Molecular Weight | 274.27 g/mol |
| Exact Mass | 274.12 |
| IUPAC Name | 5-[bis(2-hydroxyethylamino)methylidene]-2,2-dimethyl-1,3-dioxane-4,6-dione |
| SMILES | CC1(C)OC(=O)C(=C(NCCO)NCCO)C(=O)O1 |
| InChI | InChI=1S/C11H18N2O6/c1-11(2)18-9(16)7(10(17)19-11)8(12-3-5-14)13-4-6-15/h12-15H,3-6H2,1-2H3 |
| InChIKey | WMQJYXFFDCVDRY-UHFFFAOYSA-N |
| XLogP | -1.80 |
| TPSA | 117.12 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.27 |
| LogP ≤ 5 | -1.80 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|